C20H19NO3S2 — CID 129143918
[(Z)-[(3E)-3-[1-(2-methylphenyl)ethylidene]thiophen-2-ylidene]amino] 4-methylbenzenesulfonate (PubChem CID 129143918) has the molecular formula C20H19NO3S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is [(Z)-[(3E)-3-[1-(2-methylphenyl)ethylidene]thiophen-2-ylidene]amino] 4-methylbenzenesulfonate.
| Compound Name | [(Z)-[(3E)-3-[1-(2-methylphenyl)ethylidene]thiophen-2-ylidene]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 129143918 |
| Molecular Formula | C20H19NO3S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | [(Z)-[(3E)-3-[1-(2-methylphenyl)ethylidene]thiophen-2-ylidene]amino] 4-methylbenzenesulfonate |
| SMILES | C/C(=C1/C=CS/C1=N\OS(=O)(=O)c1ccc(C)cc1)c1ccccc1C |
| InChI | InChI=1S/C20H19NO3S2/c1-14-8-10-17(11-9-14)26(22,23)24-21-20-19(12-13-25-20)16(3)18-7-5-4-6-15(18)2/h4-13H,1-3H3/b19-16+,21-20- |
| InChIKey | YKMHQVBQFPWHHR-CCQVVWNHSA-N |
| XLogP | 5.06 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|