C22H24N2O3S2 — CID 134482960
[(Z)-[(3Z)-3-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino] (2-methyl-1-bicyclo[2.2.1]heptanyl)methanesulfonate (PubChem CID 134482960) has the molecular formula C22H24N2O3S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is [(Z)-[(3Z)-3-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino] (2-methyl-1-bicyclo[2.2.1]heptanyl)methanesulfonate.
| Compound Name | [(Z)-[(3Z)-3-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino] (2-methyl-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
|---|---|
| PubChem CID | 134482960 |
| Molecular Formula | C22H24N2O3S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | [(Z)-[(3Z)-3-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino] (2-methyl-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
| SMILES | Cc1ccccc1/C(C#N)=C1\C=CS\C1=N/OS(=O)(=O)CC12CCC(CC1C)C2 |
| InChI | InChI=1S/C22H24N2O3S2/c1-15-5-3-4-6-18(15)20(13-23)19-8-10-28-21(19)24-27-29(25,26)14-22-9-7-17(12-22)11-16(22)2/h3-6,8,10,16-17H,7,9,11-12,14H2,1-2H3/b20-19+,24-21- |
| InChIKey | QLOLPFSFTATHJM-MMLSESBDSA-N |
| XLogP | 5.02 |
| TPSA | 79.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|