C14H12N2O3S2 — CID 22184215
[(Z)-[(5Z)-5-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino] methanesulfonate (PubChem CID 22184215) has the molecular formula C14H12N2O3S2 and a molecular weight of 320.40 g/mol. Its IUPAC name is [(Z)-[(5Z)-5-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino] methanesulfonate.
| Compound Name | [(Z)-[(5Z)-5-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino] methanesulfonate |
|---|---|
| PubChem CID | 22184215 |
| Molecular Formula | C14H12N2O3S2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | [(Z)-[(5Z)-5-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino] methanesulfonate |
| SMILES | Cc1ccccc1/C(C#N)=C1\C=C/C(=N/OS(C)(=O)=O)S1 |
| InChI | InChI=1S/C14H12N2O3S2/c1-10-5-3-4-6-11(10)12(9-15)13-7-8-14(20-13)16-19-21(2,17)18/h3-8H,1-2H3/b13-12+,16-14- |
| InChIKey | QGJFAQNEJNPWEH-LIACPWMRSA-N |
| XLogP | 2.82 |
| TPSA | 79.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|