C16H16N2O5S3 — CID 89050341
[[(5Z)-5-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino] 1-methylsulfonylethanesulfonate (PubChem CID 89050341) has the molecular formula C16H16N2O5S3 and a molecular weight of 412.51 g/mol. Its IUPAC name is [[(5Z)-5-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino] 1-methylsulfonylethanesulfonate.
| Compound Name | [[(5Z)-5-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino] 1-methylsulfonylethanesulfonate |
|---|---|
| PubChem CID | 89050341 |
| Molecular Formula | C16H16N2O5S3 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | [[(5Z)-5-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino] 1-methylsulfonylethanesulfonate |
| SMILES | Cc1ccccc1/C(C#N)=C1\C=CC(=NOS(=O)(=O)C(C)S(C)(=O)=O)S1 |
| InChI | InChI=1S/C16H16N2O5S3/c1-11-6-4-5-7-13(11)14(10-17)15-8-9-16(24-15)18-23-26(21,22)12(2)25(3,19)20/h4-9,12H,1-3H3/b15-14+,18-16? |
| InChIKey | NBBFWZQXWYWOFA-AOZIHAJDSA-N |
| XLogP | 2.58 |
| TPSA | 113.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|