C25H18N2O6S3 — CID 91343407
[4-[[5-[cyano(phenyl)methylidene]thiophen-2-ylidene]amino]oxysulfonylphenyl] 4-methylbenzenesulfonate (PubChem CID 91343407) has the molecular formula C25H18N2O6S3 and a molecular weight of 538.63 g/mol. Its IUPAC name is [4-[[5-[cyano(phenyl)methylidene]thiophen-2-ylidene]amino]oxysulfonylphenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[[5-[cyano(phenyl)methylidene]thiophen-2-ylidene]amino]oxysulfonylphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 91343407 |
| Molecular Formula | C25H18N2O6S3 |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.03 |
| IUPAC Name | [4-[[5-[cyano(phenyl)methylidene]thiophen-2-ylidene]amino]oxysulfonylphenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(S(=O)(=O)ON=C3C=CC(=C(C#N)c4ccccc4)S3)cc2)cc1 |
| InChI | InChI=1S/C25H18N2O6S3/c1-18-7-11-21(12-8-18)35(28,29)32-20-9-13-22(14-10-20)36(30,31)33-27-25-16-15-24(34-25)23(17-26)19-5-3-2-4-6-19/h2-16H,1H3 |
| InChIKey | VCGZAYHTYVNNNS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 122.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|