C15H14N2O3S2 — CID 123801392
[[5-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino] ethanesulfonate (PubChem CID 123801392) has the molecular formula C15H14N2O3S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is [[5-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino] ethanesulfonate.
| Compound Name | [[5-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino] ethanesulfonate |
|---|---|
| PubChem CID | 123801392 |
| Molecular Formula | C15H14N2O3S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | [[5-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino] ethanesulfonate |
| SMILES | CCS(=O)(=O)ON=C1C=CC(=C(C#N)c2ccccc2C)S1 |
| InChI | InChI=1S/C15H14N2O3S2/c1-3-22(18,19)20-17-15-9-8-14(21-15)13(10-16)12-7-5-4-6-11(12)2/h4-9H,3H2,1-2H3 |
| InChIKey | GDPMNJZCJLXWLP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 79.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|