C27H22N2O6S3 — CID 87399461
[4-[[5-[cyano-(2-ethylphenyl)methylidene]thiophen-2-ylidene]amino]oxysulfonylphenyl] 4-methylbenzenesulfonate (PubChem CID 87399461) has the molecular formula C27H22N2O6S3 and a molecular weight of 566.68 g/mol. Its IUPAC name is [4-[[5-[cyano-(2-ethylphenyl)methylidene]thiophen-2-ylidene]amino]oxysulfonylphenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[[5-[cyano-(2-ethylphenyl)methylidene]thiophen-2-ylidene]amino]oxysulfonylphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87399461 |
| Molecular Formula | C27H22N2O6S3 |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.06 |
| IUPAC Name | [4-[[5-[cyano-(2-ethylphenyl)methylidene]thiophen-2-ylidene]amino]oxysulfonylphenyl] 4-methylbenzenesulfonate |
| SMILES | CCc1ccccc1C(C#N)=C1C=CC(=NOS(=O)(=O)c2ccc(OS(=O)(=O)c3ccc(C)cc3)cc2)S1 |
| InChI | InChI=1S/C27H22N2O6S3/c1-3-20-6-4-5-7-24(20)25(18-28)26-16-17-27(36-26)29-35-38(32,33)23-14-10-21(11-15-23)34-37(30,31)22-12-8-19(2)9-13-22/h4-17H,3H2,1-2H3 |
| InChIKey | HVMLNFBKTZARFV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 122.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|