C13H10N2O3S2 — CID 88579043
[[(5E)-5-[cyano(phenyl)methylidene]thiophen-2-ylidene]amino] methanesulfonate (PubChem CID 88579043) has the molecular formula C13H10N2O3S2 and a molecular weight of 306.37 g/mol. Its IUPAC name is [[(5E)-5-[cyano(phenyl)methylidene]thiophen-2-ylidene]amino] methanesulfonate.
| Compound Name | [[(5E)-5-[cyano(phenyl)methylidene]thiophen-2-ylidene]amino] methanesulfonate |
|---|---|
| PubChem CID | 88579043 |
| Molecular Formula | C13H10N2O3S2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | [[(5E)-5-[cyano(phenyl)methylidene]thiophen-2-ylidene]amino] methanesulfonate |
| SMILES | CS(=O)(=O)ON=C1C=C/C(=C(\C#N)c2ccccc2)S1 |
| InChI | InChI=1S/C13H10N2O3S2/c1-20(16,17)18-15-13-8-7-12(19-13)11(9-14)10-5-3-2-4-6-10/h2-8H,1H3/b12-11-,15-13? |
| InChIKey | WOTRZAJOLWWZNI-IQTXGCLZSA-N |
| XLogP | 2.51 |
| TPSA | 79.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|