C14H11N2O4S2- — CID 118594940
[4-[(Z)-cyano-(5-methoxyiminothiophen-2-ylidene)methyl]phenoxy]methanesulfinate (PubChem CID 118594940) has the molecular formula C14H11N2O4S2- and a molecular weight of 335.39 g/mol. Its IUPAC name is [4-[(Z)-cyano-(5-methoxyiminothiophen-2-ylidene)methyl]phenoxy]methanesulfinate.
| Compound Name | [4-[(Z)-cyano-(5-methoxyiminothiophen-2-ylidene)methyl]phenoxy]methanesulfinate |
|---|---|
| PubChem CID | 118594940 |
| Molecular Formula | C14H11N2O4S2- |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | [4-[(Z)-cyano-(5-methoxyiminothiophen-2-ylidene)methyl]phenoxy]methanesulfinate |
| SMILES | CON=C1C=C/C(=C(/C#N)c2ccc(OCS(=O)[O-])cc2)S1 |
| InChI | InChI=1S/C14H12N2O4S2/c1-19-16-14-7-6-13(21-14)12(8-15)10-2-4-11(5-3-10)20-9-22(17)18/h2-7H,9H2,1H3,(H,17,18)/p-1/b13-12+,16-14? |
| InChIKey | AKGHFALVSLPPFE-AXFLHPKGSA-M |
| XLogP | 2.40 |
| TPSA | 94.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|