C16H16N2OS — CID 87655437
2-(2-methylphenyl)-2-(5-propoxyiminothiophen-2-ylidene)acetonitrile (PubChem CID 87655437) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-(2-methylphenyl)-2-(5-propoxyiminothiophen-2-ylidene)acetonitrile.
| Compound Name | 2-(2-methylphenyl)-2-(5-propoxyiminothiophen-2-ylidene)acetonitrile |
|---|---|
| PubChem CID | 87655437 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-(2-methylphenyl)-2-(5-propoxyiminothiophen-2-ylidene)acetonitrile |
| SMILES | CCCON=C1C=CC(=C(C#N)c2ccccc2C)S1 |
| InChI | InChI=1S/C16H16N2OS/c1-3-10-19-18-16-9-8-15(20-16)14(11-17)13-7-5-4-6-12(13)2/h4-9H,3,10H2,1-2H3 |
| InChIKey | UPJVNCQXPGIRKN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|