C23H24N2O4S2 — CID 22608960
[(Z)-[(5E)-5-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino] 4,7,7-trimethyl-5-oxobicyclo[2.2.1]heptane-2-sulfonate (PubChem CID 22608960) has the molecular formula C23H24N2O4S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is [(Z)-[(5E)-5-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino] 4,7,7-trimethyl-5-oxobicyclo[2.2.1]heptane-2-sulfonate.
| Compound Name | [(Z)-[(5E)-5-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino] 4,7,7-trimethyl-5-oxobicyclo[2.2.1]heptane-2-sulfonate |
|---|---|
| PubChem CID | 22608960 |
| Molecular Formula | C23H24N2O4S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | [(Z)-[(5E)-5-[cyano-(2-methylphenyl)methylidene]thiophen-2-ylidene]amino] 4,7,7-trimethyl-5-oxobicyclo[2.2.1]heptane-2-sulfonate |
| SMILES | Cc1ccccc1/C(C#N)=C1/C=C/C(=N/OS(=O)(=O)C2CC3(C)C(=O)CC2C3(C)C)S1 |
| InChI | InChI=1S/C23H24N2O4S2/c1-14-7-5-6-8-15(14)16(13-24)18-9-10-21(30-18)25-29-31(27,28)19-12-23(4)20(26)11-17(19)22(23,2)3/h5-10,17,19H,11-12H2,1-4H3/b18-16-,25-21- |
| InChIKey | HAKSZRVCGJCERH-VSGJIUGZSA-N |
| XLogP | 4.59 |
| TPSA | 96.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|