C13H9ClN2O3S3 — CID 170234009
[(Z)-[(3Z)-3-[(2-chlorosulfanylphenyl)-cyanomethylidene]thiophen-2-ylidene]amino] methanesulfonate (PubChem CID 170234009) has the molecular formula C13H9ClN2O3S3 and a molecular weight of 372.88 g/mol. Its IUPAC name is [(Z)-[(3Z)-3-[(2-chlorosulfanylphenyl)-cyanomethylidene]thiophen-2-ylidene]amino] methanesulfonate.
| Compound Name | [(Z)-[(3Z)-3-[(2-chlorosulfanylphenyl)-cyanomethylidene]thiophen-2-ylidene]amino] methanesulfonate |
|---|---|
| PubChem CID | 170234009 |
| Molecular Formula | C13H9ClN2O3S3 |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 371.95 |
| IUPAC Name | [(Z)-[(3Z)-3-[(2-chlorosulfanylphenyl)-cyanomethylidene]thiophen-2-ylidene]amino] methanesulfonate |
| SMILES | CS(=O)(=O)O/N=C1\SC=C\C1=C(\C#N)c1ccccc1SCl |
| InChI | InChI=1S/C13H9ClN2O3S3/c1-22(17,18)19-16-13-10(6-7-20-13)11(8-15)9-4-2-3-5-12(9)21-14/h2-7H,1H3/b11-10+,16-13- |
| InChIKey | SCRQSEWCWKBWRZ-JLEYVSIISA-N |
| XLogP | 3.76 |
| TPSA | 79.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|