C28H37N5O10S — CID 172986868
tert-butyl 2-cyanoacetate;tert-butyl (2E)-2-cyano-2-hydroxyiminoacetate;tert-butyl (2E)-2-cyano-2-(4-methylphenyl)sulfonyloxyiminoacetate (PubChem CID 172986868) has the molecular formula C28H37N5O10S and a molecular weight of 635.70 g/mol. Its IUPAC name is tert-butyl 2-cyanoacetate;tert-butyl (2E)-2-cyano-2-hydroxyiminoacetate;tert-butyl (2E)-2-cyano-2-(4-methylphenyl)sulfonyloxyiminoacetate.
| Compound Name | tert-butyl 2-cyanoacetate;tert-butyl (2E)-2-cyano-2-hydroxyiminoacetate;tert-butyl (2E)-2-cyano-2-(4-methylphenyl)sulfonyloxyiminoacetate |
|---|---|
| PubChem CID | 172986868 |
| Molecular Formula | C28H37N5O10S |
| Molecular Weight | 635.70 g/mol |
| Exact Mass | 635.23 |
| IUPAC Name | tert-butyl 2-cyanoacetate;tert-butyl (2E)-2-cyano-2-hydroxyiminoacetate;tert-butyl (2E)-2-cyano-2-(4-methylphenyl)sulfonyloxyiminoacetate |
| SMILES | CC(C)(C)OC(=O)/C(C#N)=N/O.CC(C)(C)OC(=O)CC#N.Cc1ccc(S(=O)(=O)O/N=C(\C#N)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C14H16N2O5S.C7H10N2O3.C7H11NO2/c1-10-5-7-11(8-6-10)22(18,19)21-16-12(9-15)13(17)20-14(2,3)4;1-7(2,3)12-6(10)5(4-8)9-11;1-7(2,3)10-6(9)4-5-8/h5-8H,1-4H3;11H,1-3H3;4H2,1-3H3/b16-12+;9-5+; |
| InChIKey | HJKYCLMXYOSWJB-NVZYRSPMSA-N |
| XLogP | 3.85 |
| TPSA | 238.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.70 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|