C21H28N2O8S2 — CID 175321323
tert-butyl 3,3-bis[(4-methylphenyl)sulfonyloxyamino]propanoate (PubChem CID 175321323) has the molecular formula C21H28N2O8S2 and a molecular weight of 500.60 g/mol. Its IUPAC name is tert-butyl 3,3-bis[(4-methylphenyl)sulfonyloxyamino]propanoate.
| Compound Name | tert-butyl 3,3-bis[(4-methylphenyl)sulfonyloxyamino]propanoate |
|---|---|
| PubChem CID | 175321323 |
| Molecular Formula | C21H28N2O8S2 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | tert-butyl 3,3-bis[(4-methylphenyl)sulfonyloxyamino]propanoate |
| SMILES | Cc1ccc(S(=O)(=O)ONC(CC(=O)OC(C)(C)C)NOS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H28N2O8S2/c1-15-6-10-17(11-7-15)32(25,26)30-22-19(14-20(24)29-21(3,4)5)23-31-33(27,28)18-12-8-16(2)9-13-18/h6-13,19,22-23H,14H2,1-5H3 |
| InChIKey | DKWGVYGBMKOKKJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|