C21H27NO5S — CID 87296559
tert-butyl 3-amino-4-[4-(4-methylphenyl)sulfonyloxyphenyl]butanoate (PubChem CID 87296559) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is tert-butyl 3-amino-4-[4-(4-methylphenyl)sulfonyloxyphenyl]butanoate.
| Compound Name | tert-butyl 3-amino-4-[4-(4-methylphenyl)sulfonyloxyphenyl]butanoate |
|---|---|
| PubChem CID | 87296559 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | tert-butyl 3-amino-4-[4-(4-methylphenyl)sulfonyloxyphenyl]butanoate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(CC(N)CC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H27NO5S/c1-15-5-11-19(12-6-15)28(24,25)27-18-9-7-16(8-10-18)13-17(22)14-20(23)26-21(2,3)4/h5-12,17H,13-14,22H2,1-4H3 |
| InChIKey | FOEQHLBIJIPQML-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|