C20H29NO7S — CID 70678075
3-O-tert-butyl 1-O-ethyl 2-[(3E)-3-(4-methylphenyl)sulfonyloxyiminobutyl]propanedioate (PubChem CID 70678075) has the molecular formula C20H29NO7S and a molecular weight of 427.52 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-ethyl 2-[(3E)-3-(4-methylphenyl)sulfonyloxyiminobutyl]propanedioate.
| Compound Name | 3-O-tert-butyl 1-O-ethyl 2-[(3E)-3-(4-methylphenyl)sulfonyloxyiminobutyl]propanedioate |
|---|---|
| PubChem CID | 70678075 |
| Molecular Formula | C20H29NO7S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 3-O-tert-butyl 1-O-ethyl 2-[(3E)-3-(4-methylphenyl)sulfonyloxyiminobutyl]propanedioate |
| SMILES | CCOC(=O)C(CC/C(C)=N/OS(=O)(=O)c1ccc(C)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H29NO7S/c1-7-26-18(22)17(19(23)27-20(4,5)6)13-10-15(3)21-28-29(24,25)16-11-8-14(2)9-12-16/h8-9,11-12,17H,7,10,13H2,1-6H3/b21-15+ |
| InChIKey | ILXHKPVJRWLKIZ-RCCKNPSSSA-N |
| XLogP | 3.38 |
| TPSA | 108.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|