C13H18N2O4S — CID 175240201
tert-butyl 2-diazenyl-2-(4-methylphenyl)sulfonylacetate (PubChem CID 175240201) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is tert-butyl 2-diazenyl-2-(4-methylphenyl)sulfonylacetate.
| Compound Name | tert-butyl 2-diazenyl-2-(4-methylphenyl)sulfonylacetate |
|---|---|
| PubChem CID | 175240201 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | tert-butyl 2-diazenyl-2-(4-methylphenyl)sulfonylacetate |
| SMILES | [H]/N=N/C(C(=O)OC(C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H18N2O4S/c1-9-5-7-10(8-6-9)20(17,18)11(15-14)12(16)19-13(2,3)4/h5-8,11,14H,1-4H3/b15-14+ |
| InChIKey | ITKSJRVKIBSPFP-CCEZHUSRSA-N |
| XLogP | 2.47 |
| TPSA | 96.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|