C14H21NO3S2 — CID 10308556
tert-butyl 2-[[(4-methylphenyl)-methylsulfanyl-oxo-λ6-sulfanylidene]amino]acetate (PubChem CID 10308556) has the molecular formula C14H21NO3S2 and a molecular weight of 315.46 g/mol. Its IUPAC name is tert-butyl 2-[[(4-methylphenyl)-methylsulfanyl-oxo-λ6-sulfanylidene]amino]acetate.
| Compound Name | tert-butyl 2-[[(4-methylphenyl)-methylsulfanyl-oxo-λ6-sulfanylidene]amino]acetate |
|---|---|
| PubChem CID | 10308556 |
| Molecular Formula | C14H21NO3S2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | tert-butyl 2-[[(4-methylphenyl)-methylsulfanyl-oxo-λ6-sulfanylidene]amino]acetate |
| SMILES | CSS(=O)(=NCC(=O)OC(C)(C)C)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H21NO3S2/c1-11-6-8-12(9-7-11)20(17,19-5)15-10-13(16)18-14(2,3)4/h6-9H,10H2,1-5H3 |
| InChIKey | WOJMQQDDXKYYFG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|