C18H25NO5S — CID 15836338
tert-butyl 3-(4-methylphenyl)sulfonyl-3-(2-oxopyrrolidin-1-yl)propanoate (PubChem CID 15836338) has the molecular formula C18H25NO5S and a molecular weight of 367.47 g/mol. Its IUPAC name is tert-butyl 3-(4-methylphenyl)sulfonyl-3-(2-oxopyrrolidin-1-yl)propanoate.
| Compound Name | tert-butyl 3-(4-methylphenyl)sulfonyl-3-(2-oxopyrrolidin-1-yl)propanoate |
|---|---|
| PubChem CID | 15836338 |
| Molecular Formula | C18H25NO5S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | tert-butyl 3-(4-methylphenyl)sulfonyl-3-(2-oxopyrrolidin-1-yl)propanoate |
| SMILES | Cc1ccc(S(=O)(=O)C(CC(=O)OC(C)(C)C)N2CCCC2=O)cc1 |
| InChI | InChI=1S/C18H25NO5S/c1-13-7-9-14(10-8-13)25(22,23)16(19-11-5-6-15(19)20)12-17(21)24-18(2,3)4/h7-10,16H,5-6,11-12H2,1-4H3 |
| InChIKey | WKLHXXZVFUHVNX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |