C13H19NO5S — CID 175784876
1-(1-hydroxyethyl)pyrrolidin-2-one;4-methylbenzenesulfonic acid (PubChem CID 175784876) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is 1-(1-hydroxyethyl)pyrrolidin-2-one;4-methylbenzenesulfonic acid.
| Compound Name | 1-(1-hydroxyethyl)pyrrolidin-2-one;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 175784876 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 1-(1-hydroxyethyl)pyrrolidin-2-one;4-methylbenzenesulfonic acid |
| SMILES | CC(O)N1CCCC1=O.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C7H8O3S.C6H11NO2/c1-6-2-4-7(5-3-6)11(8,9)10;1-5(8)7-4-2-3-6(7)9/h2-5H,1H3,(H,8,9,10);5,8H,2-4H2,1H3 |
| InChIKey | VEUGHPAHLPXQFY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|