C16H23NO4S — CID 18724688
4-[4-(2-oxopyrrolidin-1-yl)hexan-2-yl]benzenesulfonic acid (PubChem CID 18724688) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is 4-[4-(2-oxopyrrolidin-1-yl)hexan-2-yl]benzenesulfonic acid.
| Compound Name | 4-[4-(2-oxopyrrolidin-1-yl)hexan-2-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 18724688 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 4-[4-(2-oxopyrrolidin-1-yl)hexan-2-yl]benzenesulfonic acid |
| SMILES | CCC(CC(C)c1ccc(S(=O)(=O)O)cc1)N1CCCC1=O |
| InChI | InChI=1S/C16H23NO4S/c1-3-14(17-10-4-5-16(17)18)11-12(2)13-6-8-15(9-7-13)22(19,20)21/h6-9,12,14H,3-5,10-11H2,1-2H3,(H,19,20,21) |
| InChIKey | UXOALYYRYQMVBI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|