C28H46N2O6S — CID 163907929
4-[7-(hydroxymethylcarbamoyl)-4,4,5,8,8-pentamethyl-10-(2-oxopyrrolidin-1-yl)undecan-2-yl]benzenesulfonic acid (PubChem CID 163907929) has the molecular formula C28H46N2O6S and a molecular weight of 538.75 g/mol. Its IUPAC name is 4-[7-(hydroxymethylcarbamoyl)-4,4,5,8,8-pentamethyl-10-(2-oxopyrrolidin-1-yl)undecan-2-yl]benzenesulfonic acid.
| Compound Name | 4-[7-(hydroxymethylcarbamoyl)-4,4,5,8,8-pentamethyl-10-(2-oxopyrrolidin-1-yl)undecan-2-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 163907929 |
| Molecular Formula | C28H46N2O6S |
| Molecular Weight | 538.75 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | 4-[7-(hydroxymethylcarbamoyl)-4,4,5,8,8-pentamethyl-10-(2-oxopyrrolidin-1-yl)undecan-2-yl]benzenesulfonic acid |
| SMILES | CC(CC(C)(C)C(C)CC(C(=O)NCO)C(C)(C)CC(C)N1CCCC1=O)c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C28H46N2O6S/c1-19(22-10-12-23(13-11-22)37(34,35)36)16-27(4,5)20(2)15-24(26(33)29-18-31)28(6,7)17-21(3)30-14-8-9-25(30)32/h10-13,19-21,24,31H,8-9,14-18H2,1-7H3,(H,29,33)(H,34,35,36) |
| InChIKey | QPPMJDIQVMJQKC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.75 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|