About 2-ethyl-3,3-dimethyl-N-[(2-methylbutanoylamino)methyl]-5-(2-oxopyrrolidin-1-yl)hexanamide
2-ethyl-3,3-dimethyl-N-[(2-methylbutanoylamino)methyl]-5-(2-oxopyrrolidin-1-yl)hexanamide (PubChem CID 164708886) has the molecular formula C20H37N3O3
and a molecular weight of 367.53 g/mol. Its IUPAC name is 2-ethyl-3,3-dimethyl-N-[(2-methylbutanoylamino)methyl]-5-(2-oxopyrrolidin-1-yl)hexanamide.
Molecular Properties
| Compound Name | 2-ethyl-3,3-dimethyl-N-[(2-methylbutanoylamino)methyl]-5-(2-oxopyrrolidin-1-yl)hexanamide |
| PubChem CID | 164708886 |
| Molecular Formula | C20H37N3O3 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.28 |
| IUPAC Name | 2-ethyl-3,3-dimethyl-N-[(2-methylbutanoylamino)methyl]-5-(2-oxopyrrolidin-1-yl)hexanamide |
| SMILES | CCC(C)C(=O)NCNC(=O)C(CC)C(C)(C)CC(C)N1CCCC1=O |
| InChI | InChI=1S/C20H37N3O3/c1-7-14(3)18(25)21-13-22-19(26)16(8-2)20(5,6)12-15(4)23-11-9-10-17(23)24/h14-16H,7-13H2,1-6H3,(H,21,25)(H,22,26) |
| InChIKey | DSPTVQVUZHQASB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-3,3-dimethyl-N-[(2-methylbutanoylamino)methyl]-5-(2-oxopyrrolidin-1-yl)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3,3-dimethyl-N-[(2-methylbutanoylamino)methyl]-5-(2-oxopyrrolidin-1-yl)hexanamide?
The IUPAC name of 2-ethyl-3,3-dimethyl-N-[(2-methylbutanoylamino)methyl]-5-(2-oxopyrrolidin-1-yl)hexanamide (CID 164708886) is 2-ethyl-3,3-dimethyl-N-[(2-methylbutanoylamino)methyl]-5-(2-oxopyrrolidin-1-yl)hexanamide.
What is the SMILES notation for 2-ethyl-3,3-dimethyl-N-[(2-methylbutanoylamino)methyl]-5-(2-oxopyrrolidin-1-yl)hexanamide?
The canonical SMILES for 2-ethyl-3,3-dimethyl-N-[(2-methylbutanoylamino)methyl]-5-(2-oxopyrrolidin-1-yl)hexanamide is CCC(C)C(=O)NCNC(=O)C(CC)C(C)(C)CC(C)N1CCCC1=O.
What is the InChIKey of 2-ethyl-3,3-dimethyl-N-[(2-methylbutanoylamino)methyl]-5-(2-oxopyrrolidin-1-yl)hexanamide?
The InChIKey is DSPTVQVUZHQASB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H37N3O3/c1-7-14(3)18(25)21-13-22-19(26)16(8-2)20(5,6)12-15(4)23-11-9-10-17(23)24/h14-16H,7-13H2,1-6H3,(H,21,25)(H,22,26).
What are the key properties of 2-ethyl-3,3-dimethyl-N-[(2-methylbutanoylamino)methyl]-5-(2-oxopyrrolidin-1-yl)hexanamide?
2-ethyl-3,3-dimethyl-N-[(2-methylbutanoylamino)methyl]-5-(2-oxopyrrolidin-1-yl)hexanamide has a molecular weight of 367.53 g/mol, XLogP of 2.68, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3,3-dimethyl-N-[(2-methylbutanoylamino)methyl]-5-(2-oxopyrrolidin-1-yl)hexanamide is sourced from PubChem (CID 164708886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).