C20H37N3O3 — CID 164708886
2-ethyl-3,3-dimethyl-N-[(2-methylbutanoylamino)methyl]-5-(2-oxopyrrolidin-1-yl)hexanamide (PubChem CID 164708886) has the molecular formula C20H37N3O3 and a molecular weight of 367.53 g/mol. Its IUPAC name is 2-ethyl-3,3-dimethyl-N-[(2-methylbutanoylamino)methyl]-5-(2-oxopyrrolidin-1-yl)hexanamide.
| Compound Name | 2-ethyl-3,3-dimethyl-N-[(2-methylbutanoylamino)methyl]-5-(2-oxopyrrolidin-1-yl)hexanamide |
|---|---|
| PubChem CID | 164708886 |
| Molecular Formula | C20H37N3O3 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.28 |
| IUPAC Name | 2-ethyl-3,3-dimethyl-N-[(2-methylbutanoylamino)methyl]-5-(2-oxopyrrolidin-1-yl)hexanamide |
| SMILES | CCC(C)C(=O)NCNC(=O)C(CC)C(C)(C)CC(C)N1CCCC1=O |
| InChI | InChI=1S/C20H37N3O3/c1-7-14(3)18(25)21-13-22-19(26)16(8-2)20(5,6)12-15(4)23-11-9-10-17(23)24/h14-16H,7-13H2,1-6H3,(H,21,25)(H,22,26) |
| InChIKey | DSPTVQVUZHQASB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|