C19H25NO6S — CID 134929600
diethyl 2-[(E)-3-[N-acetyl-S-(4-methylphenyl)sulfonimidoyl]prop-2-enyl]propanedioate (PubChem CID 134929600) has the molecular formula C19H25NO6S and a molecular weight of 395.48 g/mol. Its IUPAC name is diethyl 2-[(E)-3-[N-acetyl-S-(4-methylphenyl)sulfonimidoyl]prop-2-enyl]propanedioate.
| Compound Name | diethyl 2-[(E)-3-[N-acetyl-S-(4-methylphenyl)sulfonimidoyl]prop-2-enyl]propanedioate |
|---|---|
| PubChem CID | 134929600 |
| Molecular Formula | C19H25NO6S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | diethyl 2-[(E)-3-[N-acetyl-S-(4-methylphenyl)sulfonimidoyl]prop-2-enyl]propanedioate |
| SMILES | CCOC(=O)C(C/C=C/[S@](=O)(=NC(C)=O)c1ccc(C)cc1)C(=O)OCC |
| InChI | InChI=1S/C19H25NO6S/c1-5-25-18(22)17(19(23)26-6-2)8-7-13-27(24,20-15(4)21)16-11-9-14(3)10-12-16/h7,9-13,17H,5-6,8H2,1-4H3/b13-7+/t27-/m1/s1 |
| InChIKey | FUMNHICZSXQRED-HXNBDSKHSA-N |
| XLogP | 3.01 |
| TPSA | 99.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|