C17H21NO7S — CID 70676573
[(E)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)butan-2-ylideneamino] 4-methylbenzenesulfonate (PubChem CID 70676573) has the molecular formula C17H21NO7S and a molecular weight of 383.42 g/mol. Its IUPAC name is [(E)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)butan-2-ylideneamino] 4-methylbenzenesulfonate.
| Compound Name | [(E)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)butan-2-ylideneamino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 70676573 |
| Molecular Formula | C17H21NO7S |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | [(E)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)butan-2-ylideneamino] 4-methylbenzenesulfonate |
| SMILES | C/C(CCC1C(=O)OC(C)(C)OC1=O)=N\OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H21NO7S/c1-11-5-8-13(9-6-11)26(21,22)25-18-12(2)7-10-14-15(19)23-17(3,4)24-16(14)20/h5-6,8-9,14H,7,10H2,1-4H3/b18-12+ |
| InChIKey | SSCFLMSTCXNRJY-LDADJPATSA-N |
| XLogP | 2.31 |
| TPSA | 108.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|