C32H24F3NO4S — CID 164755717
[(E)-[2-oxo-1-phenyl-2-(4-propylanthracen-9-yl)ethylidene]amino] 4-(trifluoromethyl)benzenesulfonate (PubChem CID 164755717) has the molecular formula C32H24F3NO4S and a molecular weight of 575.61 g/mol. Its IUPAC name is [(E)-[2-oxo-1-phenyl-2-(4-propylanthracen-9-yl)ethylidene]amino] 4-(trifluoromethyl)benzenesulfonate.
| Compound Name | [(E)-[2-oxo-1-phenyl-2-(4-propylanthracen-9-yl)ethylidene]amino] 4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 164755717 |
| Molecular Formula | C32H24F3NO4S |
| Molecular Weight | 575.61 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | [(E)-[2-oxo-1-phenyl-2-(4-propylanthracen-9-yl)ethylidene]amino] 4-(trifluoromethyl)benzenesulfonate |
| SMILES | CCCc1cccc2c(C(=O)/C(=N/OS(=O)(=O)c3ccc(C(F)(F)F)cc3)c3ccccc3)c3ccccc3cc12 |
| InChI | InChI=1S/C32H24F3NO4S/c1-2-9-21-13-8-15-27-28(21)20-23-12-6-7-14-26(23)29(27)31(37)30(22-10-4-3-5-11-22)36-40-41(38,39)25-18-16-24(17-19-25)32(33,34)35/h3-8,10-20H,2,9H2,1H3/b36-30+ |
| InChIKey | CHTGMEASJUUCCD-FMIFUCRQSA-N |
| XLogP | 7.96 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.61 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|