C28H25NO6S — CID 164755718
[(E)-[2-[4-(2-hydroxypropoxy)naphthalen-1-yl]-2-oxo-1-phenylethylidene]amino] 4-methylbenzenesulfonate (PubChem CID 164755718) has the molecular formula C28H25NO6S and a molecular weight of 503.58 g/mol. Its IUPAC name is [(E)-[2-[4-(2-hydroxypropoxy)naphthalen-1-yl]-2-oxo-1-phenylethylidene]amino] 4-methylbenzenesulfonate.
| Compound Name | [(E)-[2-[4-(2-hydroxypropoxy)naphthalen-1-yl]-2-oxo-1-phenylethylidene]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 164755718 |
| Molecular Formula | C28H25NO6S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | [(E)-[2-[4-(2-hydroxypropoxy)naphthalen-1-yl]-2-oxo-1-phenylethylidene]amino] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O/N=C(/C(=O)c2ccc(OCC(C)O)c3ccccc23)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H25NO6S/c1-19-12-14-22(15-13-19)36(32,33)35-29-27(21-8-4-3-5-9-21)28(31)25-16-17-26(34-18-20(2)30)24-11-7-6-10-23(24)25/h3-17,20,30H,18H2,1-2H3/b29-27+ |
| InChIKey | ZMOBDSSEXUXWKR-ORIPQNMZSA-N |
| XLogP | 4.90 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|