C19H19NO7S2 — CID 130416241
2-[(Z)-C-methoxycarbonyl-N-(4-methylphenyl)sulfonyloxycarbonimidoyl]sulfanylethyl benzoate (PubChem CID 130416241) has the molecular formula C19H19NO7S2 and a molecular weight of 437.50 g/mol. Its IUPAC name is 2-[(Z)-C-methoxycarbonyl-N-(4-methylphenyl)sulfonyloxycarbonimidoyl]sulfanylethyl benzoate.
| Compound Name | 2-[(Z)-C-methoxycarbonyl-N-(4-methylphenyl)sulfonyloxycarbonimidoyl]sulfanylethyl benzoate |
|---|---|
| PubChem CID | 130416241 |
| Molecular Formula | C19H19NO7S2 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | 2-[(Z)-C-methoxycarbonyl-N-(4-methylphenyl)sulfonyloxycarbonimidoyl]sulfanylethyl benzoate |
| SMILES | COC(=O)/C(=N/OS(=O)(=O)c1ccc(C)cc1)SCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H19NO7S2/c1-14-8-10-16(11-9-14)29(23,24)27-20-17(19(22)25-2)28-13-12-26-18(21)15-6-4-3-5-7-15/h3-11H,12-13H2,1-2H3/b20-17- |
| InChIKey | OMAITMRLLCRIQO-JZJYNLBNSA-N |
| XLogP | 2.78 |
| TPSA | 108.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|