C27H24F3NO7S — CID 164755679
4-[(E)-C-[4-(cyclohexylmethoxy)naphthalene-1-carbonyl]-N-(trifluoromethylsulfonyloxy)carbonimidoyl]benzoic acid (PubChem CID 164755679) has the molecular formula C27H24F3NO7S and a molecular weight of 563.55 g/mol. Its IUPAC name is 4-[(E)-C-[4-(cyclohexylmethoxy)naphthalene-1-carbonyl]-N-(trifluoromethylsulfonyloxy)carbonimidoyl]benzoic acid.
| Compound Name | 4-[(E)-C-[4-(cyclohexylmethoxy)naphthalene-1-carbonyl]-N-(trifluoromethylsulfonyloxy)carbonimidoyl]benzoic acid |
|---|---|
| PubChem CID | 164755679 |
| Molecular Formula | C27H24F3NO7S |
| Molecular Weight | 563.55 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | 4-[(E)-C-[4-(cyclohexylmethoxy)naphthalene-1-carbonyl]-N-(trifluoromethylsulfonyloxy)carbonimidoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(/C(=N\OS(=O)(=O)C(F)(F)F)C(=O)c2ccc(OCC3CCCCC3)c3ccccc23)cc1 |
| InChI | InChI=1S/C27H24F3NO7S/c28-27(29,30)39(35,36)38-31-24(18-10-12-19(13-11-18)26(33)34)25(32)22-14-15-23(21-9-5-4-8-20(21)22)37-16-17-6-2-1-3-7-17/h4-5,8-15,17H,1-3,6-7,16H2,(H,33,34)/b31-24+ |
| InChIKey | URWSXRDNZNKZRA-QFMPWRQOSA-N |
| XLogP | 5.95 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.55 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|