C45H36N2O6S — CID 172947463
(2E)-2-hydroxyimino-1-(4-methylnaphthalen-1-yl)-2-phenylethanone;[(E)-[2-(4-methylnaphthalen-1-yl)-2-oxo-1-phenylethylidene]amino] 4-methylbenzenesulfonate (PubChem CID 172947463) has the molecular formula C45H36N2O6S and a molecular weight of 732.86 g/mol. Its IUPAC name is (2E)-2-hydroxyimino-1-(4-methylnaphthalen-1-yl)-2-phenylethanone;[(E)-[2-(4-methylnaphthalen-1-yl)-2-oxo-1-phenylethylidene]amino] 4-methylbenzenesulfonate.
| Compound Name | (2E)-2-hydroxyimino-1-(4-methylnaphthalen-1-yl)-2-phenylethanone;[(E)-[2-(4-methylnaphthalen-1-yl)-2-oxo-1-phenylethylidene]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 172947463 |
| Molecular Formula | C45H36N2O6S |
| Molecular Weight | 732.86 g/mol |
| Exact Mass | 732.23 |
| IUPAC Name | (2E)-2-hydroxyimino-1-(4-methylnaphthalen-1-yl)-2-phenylethanone;[(E)-[2-(4-methylnaphthalen-1-yl)-2-oxo-1-phenylethylidene]amino] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(C(=O)/C(=N/O)c2ccccc2)c2ccccc12.Cc1ccc(S(=O)(=O)O/N=C(/C(=O)c2ccc(C)c3ccccc23)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H21NO4S.C19H15NO2/c1-18-12-15-21(16-13-18)32(29,30)31-27-25(20-8-4-3-5-9-20)26(28)24-17-14-19(2)22-10-6-7-11-23(22)24;1-13-11-12-17(16-10-6-5-9-15(13)16)19(21)18(20-22)14-7-3-2-4-8-14/h3-17H,1-2H3;2-12,22H,1H3/b27-25+;20-18+ |
| InChIKey | JNPBUXPIZBEVHU-CKXGDTRCSA-N |
| XLogP | 9.66 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.86 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|