C22H19NO4S — CID 123773464
[(4-oxo-1,4-diphenylbutylidene)amino] benzenesulfonate (PubChem CID 123773464) has the molecular formula C22H19NO4S and a molecular weight of 393.46 g/mol. Its IUPAC name is [(4-oxo-1,4-diphenylbutylidene)amino] benzenesulfonate.
| Compound Name | [(4-oxo-1,4-diphenylbutylidene)amino] benzenesulfonate |
|---|---|
| PubChem CID | 123773464 |
| Molecular Formula | C22H19NO4S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | [(4-oxo-1,4-diphenylbutylidene)amino] benzenesulfonate |
| SMILES | O=C(CCC(=NOS(=O)(=O)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19NO4S/c24-22(19-12-6-2-7-13-19)17-16-21(18-10-4-1-5-11-18)23-27-28(25,26)20-14-8-3-9-15-20/h1-15H,16-17H2 |
| InChIKey | REVVAUMQIOUAOI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|