C19H23NO2Si — CID 88532056
1,4-diphenyl-4-trimethylsilyloxyiminobutan-1-one (PubChem CID 88532056) has the molecular formula C19H23NO2Si and a molecular weight of 325.48 g/mol. Its IUPAC name is 1,4-diphenyl-4-trimethylsilyloxyiminobutan-1-one.
| Compound Name | 1,4-diphenyl-4-trimethylsilyloxyiminobutan-1-one |
|---|---|
| PubChem CID | 88532056 |
| Molecular Formula | C19H23NO2Si |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 1,4-diphenyl-4-trimethylsilyloxyiminobutan-1-one |
| SMILES | C[Si](C)(C)ON=C(CCC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H23NO2Si/c1-23(2,3)22-20-18(16-10-6-4-7-11-16)14-15-19(21)17-12-8-5-9-13-17/h4-13H,14-15H2,1-3H3 |
| InChIKey | KRGBUNDYYWCKCN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|