C23H34N2OSi2 — CID 140633116
5-[bis(trimethylsilyl)hydrazinylidene]-1,5-diphenylpentan-1-one (PubChem CID 140633116) has the molecular formula C23H34N2OSi2 and a molecular weight of 410.71 g/mol. Its IUPAC name is 5-[bis(trimethylsilyl)hydrazinylidene]-1,5-diphenylpentan-1-one.
| Compound Name | 5-[bis(trimethylsilyl)hydrazinylidene]-1,5-diphenylpentan-1-one |
|---|---|
| PubChem CID | 140633116 |
| Molecular Formula | C23H34N2OSi2 |
| Molecular Weight | 410.71 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 5-[bis(trimethylsilyl)hydrazinylidene]-1,5-diphenylpentan-1-one |
| SMILES | C[Si](C)(C)N(N=C(CCCC(=O)c1ccccc1)c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C23H34N2OSi2/c1-27(2,3)25(28(4,5)6)24-22(20-14-9-7-10-15-20)18-13-19-23(26)21-16-11-8-12-17-21/h7-12,14-17H,13,18-19H2,1-6H3 |
| InChIKey | QZRGJTHWUGRHTQ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.71 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|