C20H17NO4S — CID 172989069
[(E)-[2-(4-methylnaphthalen-1-yl)-2-oxo-1-phenylethylidene]amino] methanesulfonate (PubChem CID 172989069) has the molecular formula C20H17NO4S and a molecular weight of 367.43 g/mol. Its IUPAC name is [(E)-[2-(4-methylnaphthalen-1-yl)-2-oxo-1-phenylethylidene]amino] methanesulfonate.
| Compound Name | [(E)-[2-(4-methylnaphthalen-1-yl)-2-oxo-1-phenylethylidene]amino] methanesulfonate |
|---|---|
| PubChem CID | 172989069 |
| Molecular Formula | C20H17NO4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | [(E)-[2-(4-methylnaphthalen-1-yl)-2-oxo-1-phenylethylidene]amino] methanesulfonate |
| SMILES | Cc1ccc(C(=O)/C(=N/OS(C)(=O)=O)c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C20H17NO4S/c1-14-12-13-18(17-11-7-6-10-16(14)17)20(22)19(21-25-26(2,23)24)15-8-4-3-5-9-15/h3-13H,1-2H3/b21-19+ |
| InChIKey | HOABZWSSQLDQAF-XUTLUUPISA-N |
| XLogP | 3.71 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|