C26H16F3NO5S — CID 164755691
[(E)-[2-(4-benzoylnaphthalen-1-yl)-2-oxo-1-phenylethylidene]amino] trifluoromethanesulfonate (PubChem CID 164755691) has the molecular formula C26H16F3NO5S and a molecular weight of 511.48 g/mol. Its IUPAC name is [(E)-[2-(4-benzoylnaphthalen-1-yl)-2-oxo-1-phenylethylidene]amino] trifluoromethanesulfonate.
| Compound Name | [(E)-[2-(4-benzoylnaphthalen-1-yl)-2-oxo-1-phenylethylidene]amino] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 164755691 |
| Molecular Formula | C26H16F3NO5S |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | [(E)-[2-(4-benzoylnaphthalen-1-yl)-2-oxo-1-phenylethylidene]amino] trifluoromethanesulfonate |
| SMILES | O=C(/C(=N/OS(=O)(=O)C(F)(F)F)c1ccccc1)c1ccc(C(=O)c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C26H16F3NO5S/c27-26(28,29)36(33,34)35-30-23(17-9-3-1-4-10-17)25(32)22-16-15-21(19-13-7-8-14-20(19)22)24(31)18-11-5-2-6-12-18/h1-16H/b30-23+ |
| InChIKey | GBYZDXLLNJLPMV-JJKYIXSRSA-N |
| XLogP | 5.52 |
| TPSA | 89.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|