C19H16N2O5S — CID 68977534
3-[(4-methylnaphthalene-1-carbonyl)amino]-6-methylsulfonylpyridine-2-carboxylic acid (PubChem CID 68977534) has the molecular formula C19H16N2O5S and a molecular weight of 384.41 g/mol. Its IUPAC name is 3-[(4-methylnaphthalene-1-carbonyl)amino]-6-methylsulfonylpyridine-2-carboxylic acid.
| Compound Name | 3-[(4-methylnaphthalene-1-carbonyl)amino]-6-methylsulfonylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 68977534 |
| Molecular Formula | C19H16N2O5S |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 3-[(4-methylnaphthalene-1-carbonyl)amino]-6-methylsulfonylpyridine-2-carboxylic acid |
| SMILES | Cc1ccc(C(=O)Nc2ccc(S(C)(=O)=O)nc2C(=O)O)c2ccccc12 |
| InChI | InChI=1S/C19H16N2O5S/c1-11-7-8-14(13-6-4-3-5-12(11)13)18(22)20-15-9-10-16(27(2,25)26)21-17(15)19(23)24/h3-10H,1-2H3,(H,20,22)(H,23,24) |
| InChIKey | QSYQVMLYZMGSOH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |