C19H21NO7S — CID 22648636
ethyl (2E)-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfonyloxyiminoacetate (PubChem CID 22648636) has the molecular formula C19H21NO7S and a molecular weight of 407.44 g/mol. Its IUPAC name is ethyl (2E)-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfonyloxyiminoacetate.
| Compound Name | ethyl (2E)-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfonyloxyiminoacetate |
|---|---|
| PubChem CID | 22648636 |
| Molecular Formula | C19H21NO7S |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | ethyl (2E)-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfonyloxyiminoacetate |
| SMILES | CCOC(=O)/C(=N/OS(=O)(=O)c1ccc(C)cc1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H21NO7S/c1-5-26-19(21)18(14-8-11-16(24-3)17(12-14)25-4)20-27-28(22,23)15-9-6-13(2)7-10-15/h6-12H,5H2,1-4H3/b20-18+ |
| InChIKey | DXEMTRTWVFHJGL-CZIZESTLSA-N |
| XLogP | 2.68 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|