C14H19NO8S — CID 123464873
1-methoxyethyl 2-(3,4-dimethoxyphenyl)-2-methylsulfonyloxyiminoacetate (PubChem CID 123464873) has the molecular formula C14H19NO8S and a molecular weight of 361.37 g/mol. Its IUPAC name is 1-methoxyethyl 2-(3,4-dimethoxyphenyl)-2-methylsulfonyloxyiminoacetate.
| Compound Name | 1-methoxyethyl 2-(3,4-dimethoxyphenyl)-2-methylsulfonyloxyiminoacetate |
|---|---|
| PubChem CID | 123464873 |
| Molecular Formula | C14H19NO8S |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 1-methoxyethyl 2-(3,4-dimethoxyphenyl)-2-methylsulfonyloxyiminoacetate |
| SMILES | COc1ccc(C(=NOS(C)(=O)=O)C(=O)OC(C)OC)cc1OC |
| InChI | InChI=1S/C14H19NO8S/c1-9(19-2)22-14(16)13(15-23-24(5,17)18)10-6-7-11(20-3)12(8-10)21-4/h6-9H,1-5H3 |
| InChIKey | FQCMHPXNDOODJA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 109.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|