C19H22O3 — CID 14297404
(3,4-dimethoxyphenyl)-[4-(2-methylpropyl)phenyl]methanone (PubChem CID 14297404) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-[4-(2-methylpropyl)phenyl]methanone.
| Compound Name | (3,4-dimethoxyphenyl)-[4-(2-methylpropyl)phenyl]methanone |
|---|---|
| PubChem CID | 14297404 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (3,4-dimethoxyphenyl)-[4-(2-methylpropyl)phenyl]methanone |
| SMILES | COc1ccc(C(=O)c2ccc(CC(C)C)cc2)cc1OC |
| InChI | InChI=1S/C19H22O3/c1-13(2)11-14-5-7-15(8-6-14)19(20)16-9-10-17(21-3)18(12-16)22-4/h5-10,12-13H,11H2,1-4H3 |
| InChIKey | BDAXKKSKLDWETJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |