C14H20NO8P — CID 73414404
2-diethoxyphosphoryloxyimino-2-(3,4-dimethoxyphenyl)acetic acid (PubChem CID 73414404) has the molecular formula C14H20NO8P and a molecular weight of 361.29 g/mol. Its IUPAC name is 2-diethoxyphosphoryloxyimino-2-(3,4-dimethoxyphenyl)acetic acid.
| Compound Name | 2-diethoxyphosphoryloxyimino-2-(3,4-dimethoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 73414404 |
| Molecular Formula | C14H20NO8P |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 2-diethoxyphosphoryloxyimino-2-(3,4-dimethoxyphenyl)acetic acid |
| SMILES | CCOP(=O)(OCC)ON=C(C(=O)O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H20NO8P/c1-5-21-24(18,22-6-2)23-15-13(14(16)17)10-7-8-11(19-3)12(9-10)20-4/h7-9H,5-6H2,1-4H3,(H,16,17) |
| InChIKey | IPICHDRFAVZJNJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|