C22H29O8P — CID 59330764
diethyl [2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate (PubChem CID 59330764) has the molecular formula C22H29O8P and a molecular weight of 452.44 g/mol. Its IUPAC name is diethyl [2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate.
| Compound Name | diethyl [2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate |
|---|---|
| PubChem CID | 59330764 |
| Molecular Formula | C22H29O8P |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | diethyl [2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate |
| SMILES | C=C(c1ccc(OC)c(OP(=O)(OCC)OCC)c1)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H29O8P/c1-8-28-31(23,29-9-2)30-19-12-16(10-11-18(19)24-4)15(3)17-13-20(25-5)22(27-7)21(14-17)26-6/h10-14H,3,8-9H2,1-2,4-7H3 |
| InChIKey | NOLCLOXFZFUARI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|