C17H18FNO4 — CID 71698290
2-fluoro-3-methoxy-6-[1-(3,4,5-trimethoxyphenyl)ethenyl]pyridine (PubChem CID 71698290) has the molecular formula C17H18FNO4 and a molecular weight of 319.33 g/mol. Its IUPAC name is 2-fluoro-3-methoxy-6-[1-(3,4,5-trimethoxyphenyl)ethenyl]pyridine.
| Compound Name | 2-fluoro-3-methoxy-6-[1-(3,4,5-trimethoxyphenyl)ethenyl]pyridine |
|---|---|
| PubChem CID | 71698290 |
| Molecular Formula | C17H18FNO4 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-fluoro-3-methoxy-6-[1-(3,4,5-trimethoxyphenyl)ethenyl]pyridine |
| SMILES | C=C(c1cc(OC)c(OC)c(OC)c1)c1ccc(OC)c(F)n1 |
| InChI | InChI=1S/C17H18FNO4/c1-10(12-6-7-13(20-2)17(18)19-12)11-8-14(21-3)16(23-5)15(9-11)22-4/h6-9H,1H2,2-5H3 |
| InChIKey | SRRCODGBHNKNQV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|