C18H20N2O6 — CID 130227383
N-hydroxy-3-methoxy-6-[1-(3,4,5-trimethoxyphenyl)ethenyl]pyridine-2-carboxamide (PubChem CID 130227383) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is N-hydroxy-3-methoxy-6-[1-(3,4,5-trimethoxyphenyl)ethenyl]pyridine-2-carboxamide.
| Compound Name | N-hydroxy-3-methoxy-6-[1-(3,4,5-trimethoxyphenyl)ethenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 130227383 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-hydroxy-3-methoxy-6-[1-(3,4,5-trimethoxyphenyl)ethenyl]pyridine-2-carboxamide |
| SMILES | C=C(c1cc(OC)c(OC)c(OC)c1)c1ccc(OC)c(C(=O)NO)n1 |
| InChI | InChI=1S/C18H20N2O6/c1-10(11-8-14(24-3)17(26-5)15(9-11)25-4)12-6-7-13(23-2)16(19-12)18(21)20-22/h6-9,22H,1H2,2-5H3,(H,20,21) |
| InChIKey | MZPRIMYIKDOWQC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 99.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|