C19H22N2O4 — CID 2352026
3,4,5-trimethoxy-N'-[1-(4-methylphenyl)ethenyl]benzohydrazide (PubChem CID 2352026) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N'-[1-(4-methylphenyl)ethenyl]benzohydrazide.
| Compound Name | 3,4,5-trimethoxy-N'-[1-(4-methylphenyl)ethenyl]benzohydrazide |
|---|---|
| PubChem CID | 2352026 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 3,4,5-trimethoxy-N'-[1-(4-methylphenyl)ethenyl]benzohydrazide |
| SMILES | C=C(NNC(=O)c1cc(OC)c(OC)c(OC)c1)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H22N2O4/c1-12-6-8-14(9-7-12)13(2)20-21-19(22)15-10-16(23-3)18(25-5)17(11-15)24-4/h6-11,20H,2H2,1,3-5H3,(H,21,22) |
| InChIKey | XYXKTCSVMZWXOH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|