C24H23N3O4S — CID 2366127
3,4,5-trimethoxy-N'-[1-(10H-phenothiazin-2-yl)ethenyl]benzohydrazide (PubChem CID 2366127) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N'-[1-(10H-phenothiazin-2-yl)ethenyl]benzohydrazide.
| Compound Name | 3,4,5-trimethoxy-N'-[1-(10H-phenothiazin-2-yl)ethenyl]benzohydrazide |
|---|---|
| PubChem CID | 2366127 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 3,4,5-trimethoxy-N'-[1-(10H-phenothiazin-2-yl)ethenyl]benzohydrazide |
| SMILES | C=C(NNC(=O)c1cc(OC)c(OC)c(OC)c1)c1ccc2c(c1)Nc1ccccc1S2 |
| InChI | InChI=1S/C24H23N3O4S/c1-14(15-9-10-22-18(11-15)25-17-7-5-6-8-21(17)32-22)26-27-24(28)16-12-19(29-2)23(31-4)20(13-16)30-3/h5-13,25-26H,1H2,2-4H3,(H,27,28) |
| InChIKey | NCPVFPDVHYWAOX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|