C22H22N2O5 — CID 5174774
3-hydroxy-N'-[1-(3,4,5-trimethoxyphenyl)ethenyl]naphthalene-2-carbohydrazide (PubChem CID 5174774) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is 3-hydroxy-N'-[1-(3,4,5-trimethoxyphenyl)ethenyl]naphthalene-2-carbohydrazide.
| Compound Name | 3-hydroxy-N'-[1-(3,4,5-trimethoxyphenyl)ethenyl]naphthalene-2-carbohydrazide |
|---|---|
| PubChem CID | 5174774 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 3-hydroxy-N'-[1-(3,4,5-trimethoxyphenyl)ethenyl]naphthalene-2-carbohydrazide |
| SMILES | C=C(NNC(=O)c1cc2ccccc2cc1O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H22N2O5/c1-13(16-11-19(27-2)21(29-4)20(12-16)28-3)23-24-22(26)17-9-14-7-5-6-8-15(14)10-18(17)25/h5-12,23,25H,1H2,2-4H3,(H,24,26) |
| InChIKey | SZZBSRNRDVDWFA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|