C28H41O5Si — CID 25069662
CID 25069662 (PubChem CID 25069662) has the molecular formula C28H41O5Si and a molecular weight of 485.72 g/mol.
| Compound Name | CID 25069662 |
|---|---|
| PubChem CID | 25069662 |
| Molecular Formula | C28H41O5Si |
| Molecular Weight | 485.72 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | — |
| SMILES | C=C(c1ccc(OC)c(O[Si](CC(C)(C)C)CC(C)(C)C)c1)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C28H41O5Si/c1-19(21-15-24(30-9)26(32-11)25(16-21)31-10)20-12-13-22(29-8)23(14-20)33-34(17-27(2,3)4)18-28(5,6)7/h12-16H,1,17-18H2,2-11H3 |
| InChIKey | CHFDPANBDVXSBX-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.72 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|