C32H37Cl2NO6 — CID 59330740
[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate (PubChem CID 59330740) has the molecular formula C32H37Cl2NO6 and a molecular weight of 602.56 g/mol. Its IUPAC name is [2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate.
| Compound Name | [2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate |
|---|---|
| PubChem CID | 59330740 |
| Molecular Formula | C32H37Cl2NO6 |
| Molecular Weight | 602.56 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | [2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate |
| SMILES | C=C(c1ccc(OC)c(OC(=O)CCCc2ccc(N(CCCl)CCCl)cc2)c1)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C32H37Cl2NO6/c1-22(25-20-29(38-3)32(40-5)30(21-25)39-4)24-11-14-27(37-2)28(19-24)41-31(36)8-6-7-23-9-12-26(13-10-23)35(17-15-33)18-16-34/h9-14,19-21H,1,6-8,15-18H2,2-5H3 |
| InChIKey | ZBIABELZWFXWEC-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.56 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|