About (2-oxochromen-7-yl) 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate
(2-oxochromen-7-yl) 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate (PubChem CID 102089826) has the molecular formula C23H23Cl2NO4
and a molecular weight of 448.35 g/mol. Its IUPAC name is (2-oxochromen-7-yl) 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate.
Molecular Properties
| Compound Name | (2-oxochromen-7-yl) 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate |
| PubChem CID | 102089826 |
| Molecular Formula | C23H23Cl2NO4 |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | (2-oxochromen-7-yl) 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate |
| SMILES | O=C(CCCc1ccc(N(CCCl)CCCl)cc1)Oc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C23H23Cl2NO4/c24-12-14-26(15-13-25)19-8-4-17(5-9-19)2-1-3-22(27)29-20-10-6-18-7-11-23(28)30-21(18)16-20/h4-11,16H,1-3,12-15H2 |
| InChIKey | MWBZPPRJWLTIBK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-oxochromen-7-yl) 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxochromen-7-yl) 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate?
The IUPAC name of (2-oxochromen-7-yl) 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate (CID 102089826) is (2-oxochromen-7-yl) 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate.
What is the SMILES notation for (2-oxochromen-7-yl) 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate?
The canonical SMILES for (2-oxochromen-7-yl) 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate is O=C(CCCc1ccc(N(CCCl)CCCl)cc1)Oc1ccc2ccc(=O)oc2c1.
What is the InChIKey of (2-oxochromen-7-yl) 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate?
The InChIKey is MWBZPPRJWLTIBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23Cl2NO4/c24-12-14-26(15-13-25)19-8-4-17(5-9-19)2-1-3-22(27)29-20-10-6-18-7-11-23(28)30-21(18)16-20/h4-11,16H,1-3,12-15H2.
What are the key properties of (2-oxochromen-7-yl) 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate?
(2-oxochromen-7-yl) 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate has a molecular weight of 448.35 g/mol, XLogP of 5.01, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxochromen-7-yl) 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate is sourced from PubChem (CID 102089826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).