About (2-oxochromen-7-yl) 2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetate
(2-oxochromen-7-yl) 2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetate (PubChem CID 16574806) has the molecular formula C19H13ClO6
and a molecular weight of 372.76 g/mol. Its IUPAC name is (2-oxochromen-7-yl) 2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetate.
Molecular Properties
| Compound Name | (2-oxochromen-7-yl) 2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetate |
| PubChem CID | 16574806 |
| Molecular Formula | C19H13ClO6 |
| Molecular Weight | 372.76 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | (2-oxochromen-7-yl) 2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetate |
| SMILES | O=C(Cc1cc(Cl)c2c(c1)OCCO2)Oc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C19H13ClO6/c20-14-7-11(8-16-19(14)24-6-5-23-16)9-18(22)25-13-3-1-12-2-4-17(21)26-15(12)10-13/h1-4,7-8,10H,5-6,9H2 |
| InChIKey | WFJDSMMOFUFDAA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.76 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-oxochromen-7-yl) 2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxochromen-7-yl) 2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetate?
The IUPAC name of (2-oxochromen-7-yl) 2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetate (CID 16574806) is (2-oxochromen-7-yl) 2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetate.
What is the SMILES notation for (2-oxochromen-7-yl) 2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetate?
The canonical SMILES for (2-oxochromen-7-yl) 2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetate is O=C(Cc1cc(Cl)c2c(c1)OCCO2)Oc1ccc2ccc(=O)oc2c1.
What is the InChIKey of (2-oxochromen-7-yl) 2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetate?
The InChIKey is WFJDSMMOFUFDAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13ClO6/c20-14-7-11(8-16-19(14)24-6-5-23-16)9-18(22)25-13-3-1-12-2-4-17(21)26-15(12)10-13/h1-4,7-8,10H,5-6,9H2.
What are the key properties of (2-oxochromen-7-yl) 2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetate?
(2-oxochromen-7-yl) 2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetate has a molecular weight of 372.76 g/mol, XLogP of 3.37, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxochromen-7-yl) 2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetate is sourced from PubChem (CID 16574806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).